On Target NS3_HCV1B 0.22279793/CHEMBL3954962
For the given ligand Famciclovir, we have found in our database that, being scored 0.22279793, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |