On Target NS3_HCV1A 0.39473686/CHEMBL3696817
For the given ligand Famciclovir, we have found in our database that, being scored 0.39473686, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| Famciclovir (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| CC(=O)OCC(CCn2cnc1cnc(N)nc12)COC(C)=O | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 0000000a 00801800 00080100 00010700 00180040 0000c000 0000a000 00000800 00400100 010000c0 0000800c 40019000 00009000 00800000 00080080 100c100c 00020000 00000000 09400000 00200001 80000020 1c000a50 21800840 00400014 00000400 00000000 00000200 00000000 00000208 0046100a c0080000 00000080 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |