On Target NSP15_SARS 0.15048544/CHEMBL2441741
For the given ligand Adefovir dipivoxil, we have found in our database that, being scored 0.15048544, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Adefovir dipivoxil (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC(C)(C)C(=O)OCOP(=O)(COCCn2cnc1c(N)ncnc12)OCOC(=O)C(C)(C)C | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48090e20 000c0045 0000c101 0000c902 10000800 00400108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 15422a60 23800040 04000214 00020000 00000000 02000200 28a14030 00000208 00460000 c0080000 000080c4 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |