On Target NS3_HCV1B 0.17133956/CHEMBL3125634
For the given ligand Adefovir dipivoxil, we have found in our database that, being scored 0.17133956, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Adefovir dipivoxil (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| CC(C)(C)C(=O)OCOP(=O)(COCCn2cnc1c(N)ncnc12)OCOC(=O)C(C)(C)C | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48090e20 000c0045 0000c101 0000c902 10000800 00400108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 15422a60 23800040 04000214 00020000 00000000 02000200 28a14030 00000208 00460000 c0080000 000080c4 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |