On Target NS3_HCV1A 0.33493975/CHEMBL3896463
For the given ligand Baloxavir marboxil, we have found in our database that, being scored 0.33493975, the most similar ligand is CHEMBL3896463. Check out the elaboration below.
| Baloxavir marboxil (Given Ligand) | CHEMBL3896463 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CNC(=O)c1c(C(=O)N2CCOCC2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(n3)-c3cc5c(F)cccc5n3CO4)cc12 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0001629a 00204828 6218490a d2310e02 0d8412e1 02008134 00ad0490 62283240 06074140 702008d0 8421a134 40359410 c4008c37 08681089 c12a5c68 221e210d 10264000 12032004 0e300000 14524226 401a0000 3a068e9e f3800020 8058c20c 098024ac e0014002 34d24654 988410cf 0040e38c 11278441 c0141a00 00010260 |