On Target PLP_SARS 0.19473684/CHEMBL213054
For the given ligand Idoxuridine, we have found in our database that, being scored 0.19473684, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |