On Target NP_HCoV-OC43 0.14569536/CHEMBL3233481
For the given ligand Idoxuridine, we have found in our database that, being scored 0.14569536, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |