On Target NA_INFB 0.24528302/CHEMBL183817
For the given ligand Idoxuridine, we have found in our database that, being scored 0.24528302, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |