On Target NS5B_HCV1B 0.1969697/CHEMBL3645211
For the given ligand Idoxuridine, we have found in our database that, being scored 0.1969697, the most similar ligand is CHEMBL3645211. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL3645211 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | CNC(=O)c1c2cc(C3CC3)c(N(CCC3COC(C)(C)OC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 00004006 0480de08 20180902 41310f00 211c0040 00006042 02840800 02001408 00300900 014908e0 09312024 40118800 80008c33 01400201 804a0040 002e300e 04268000 02000004 09608008 00224201 c0100121 1c838e38 2180c800 9360001c 02104480 c0000040 00270280 b400108c 0c488304 0046004b c4248088 a8114ff0 |