On Target NS5B_HCV1B 0.25641027/CHEMBL3645200
For the given ligand Nevirapine, we have found in our database that, being scored 0.25641027, the most similar ligand is CHEMBL3645200. Check out the elaboration below.
| Nevirapine (Given Ligand) | CHEMBL3645200 (Similar Ligand) |
|---|---|
| Cc1ccnc3c1[nH]c(=O)c2cccnc2n3C4CC4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccnc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 0200002a 00800800 00084100 00040610 000c1040 0000c040 00008000 00000000 06400100 c00000e0 0d00000c 40010000 80009800 01e00000 003400c0 000c0004 08000000 0280c000 00600000 00000000 c0000000 18008070 21800041 80100414 00040000 c0000000 08008000 00040000 00000000 00460000 c00c0000 000004a0 | 10004006 0080de08 20184902 41310e10 210c1000 00004042 02044000 02001408 00100900 004909e0 09312024 40118800 80008c33 01400201 808a0440 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8f8e38 2080c800 9360001c 02144080 c0000048 08270080 8000108c 0c488104 0046005b e4048088 a81147e0 |