On Target RT_HIV1 0.30057803/CHEMBL4278516
For the given ligand Idoxuridine, we have found in our database that, being scored 0.30057803, the most similar ligand is CHEMBL4278516. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL4278516 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | O=c1[nH]c(Sc2ccc(Br)cc2)c(I)c(=O)n1O |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 01004002 40c08200 60020420 02180600 00040000 00004000 00010002 40001000 06000100 00000861 04000004 3000a000 00008a12 024000c0 00200000 000c0014 04001048 00018000 80600110 00001004 90882080 4c028010 20800840 40980019 00050000 c8000000 60020010 00840000 00084a00 01460000 40200018 080120e0 |