On Target PR_HIV1 0.22535211/CHEMBL450294
For the given ligand Idoxuridine, we have found in our database that, being scored 0.22535211, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Idoxuridine (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| O=c2[nH]c(=O)n([C@H]1C[C@H](O)[C@@H](CO)O1)cc2I | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 00000002 01400000 00200400 82030600 00180060 00004140 00000402 04000000 06000100 818000b0 0c00000c 40018000 00009280 03c80110 00a81080 001c800c 00200000 00008000 09c00100 00001001 800a00a0 10000010 25800041 08300010 10050400 c0000002 20000200 10040060 00004200 01460000 40280010 00000080 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |