On Target NS3_HCV1B 0.22695035/CHEMBL3125634
For the given ligand Nevirapine, we have found in our database that, being scored 0.22695035, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Nevirapine (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| Cc1ccnc3c1[nH]c(=O)c2cccnc2n3C4CC4 | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 0200002a 00800800 00084100 00040610 000c1040 0000c040 00008000 00000000 06400100 c00000e0 0d00000c 40010000 80009800 01e00000 003400c0 000c0004 08000000 0280c000 00600000 00000000 c0000000 18008070 21800041 80100414 00040000 c0000000 08008000 00040000 00000000 00460000 c00c0000 000004a0 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |