On Target NS5B_HCV1A 0.5252918/CHEMBL3644909
For the given ligand Asunaprevir, we have found in our database that, being scored 0.5252918, the most similar ligand is CHEMBL3644909. Check out the elaboration below.
| Asunaprevir (Given Ligand) | CHEMBL3644909 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]4C[C@@H](Oc2ncc(OC)c3ccc(Cl)cc23)CN4C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)NS(=O)(=O)C5CC5 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(OC)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0405a082 0d407018 60104108 05310702 80141080 02018114 160a0000 20201428 10810200 005088c8 00242404 4005b800 0e80c81e 09442003 b1581541 001ea00c 12224000 00080500 40e10810 00024201 40020040 bc148f38 33a00083 b2148038 02002401 00000002 00980200 9020802d 08000200 80060081 a4044000 07032a70 | 00014086 0d403408 20100128 05310f00 20081000 00018000 020a0004 a0003409 10800200 00528be8 00202404 5001b000 0e00f022 01042101 81420441 001a8008 02864010 00482000 48610850 00024a01 60100100 bc050e10 21020003 3204003a 02112000 00001002 00040000 902000ac 08008200 81060093 a4184000 01016270 |