On Target PR_HIV1 0.33333334/CHEMBL494499
For the given ligand Voxilaprevir, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL494499. Check out the elaboration below.
| Voxilaprevir (Given Ligand) | CHEMBL494499 (Similar Ligand) |
|---|---|
| CC[C@@H]5[C@@H]4CN(C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1C[C@@H]1CCCCC(F)(F)c3nc2ccc(OC)cc2nc3O4)[C@@H]5C(=O)N[C@]7(C(=O)NS(=O)(=O)C6(C)CC6)C[C@H]7C(F)F | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@@H]2CCCCOC2)cc1 |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b11710 801c1de0 86018114 070aa803 a0609208 10c10a00 004888f0 0424a404 4085b040 0e00c816 09c42903 f1fe1141 021ea40c 1aaa0020 260a8104 00e02c18 00064201 50120040 bc148e30 33a00083 72168438 02042403 40001082 08808260 902000ad 0c000306 06864803 a0064000 25212a70 | 00000050 01c05409 2110050a 01b10700 00081080 00028000 02000000 a0000044 00542a00 004809e0 08342000 60018010 00008002 02a00101 81e80001 001a9008 10822000 02080000 00402800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102000ec 04000600 20060013 80000000 00012670 |