On Target PR_HIV1 0.33118972/CHEMBL494499
For the given ligand Grazoprevir, we have found in our database that, being scored 0.33118972, the most similar ligand is CHEMBL494499. Check out the elaboration below.
| Grazoprevir (Given Ligand) | CHEMBL494499 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]2C[C@@H]6CN2C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]3C[C@H]3CCCCCc5nc4ccc(OC)cc4nc5O6)C(=O)NS(=O)(=O)C7CC7 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@@H]2CCCCOC2)cc1 |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b10710 801c11e0 86018114 070aa003 a0609608 10c10a00 005888c8 0024a404 4085b040 0e00c816 09c42903 f1de1541 021ea00c 1aa24000 260a8104 40e12c18 00064201 40120040 bc148e30 33a00083 32148438 02042401 40001002 08808200 902000ad 0c000306 80864883 a4064000 25212a70 | 00000050 01c05409 2110050a 01b10700 00081080 00028000 02000000 a0000044 00542a00 004809e0 08342000 60018010 00008002 02a00101 81e80001 001a9008 10822000 02080000 00402800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000100e 00800000 102000ec 04000600 20060013 80000000 00012670 |