On Target NP_HCoV-OC43 0.1754386/CHEMBL3233481
For the given ligand Efavirenz, we have found in our database that, being scored 0.1754386, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Efavirenz (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C3Nc1ccc(Cl)cc1[C@@](C#CC2CC2)(C(F)(F)F)O3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 01008202 94400008 00100100 00011200 00402000 00006020 04200001 00000200 00000304 40080844 082804a4 42009808 0e028004 01310001 80020040 42392008 00168480 02c00400 0a040890 00400801 60000208 08000d30 2000a002 00f00110 00002000 80402102 00080014 90001088 00808200 81060003 40000884 22020600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |