On Target NA_INFB 0.16759777/CHEMBL4126987
For the given ligand Cidofovir, we have found in our database that, being scored 0.16759777, the most similar ligand is CHEMBL4126987. Check out the elaboration below.
| Cidofovir (Given Ligand) | CHEMBL4126987 (Similar Ligand) |
|---|---|
| Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | CC(=O)N[C@@H]1C[C@@H](F)[C@](F)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
|
|
|
|
|
|
| 00000002 00100800 80000000 48080600 00080061 00004100 00009002 00000800 0400010a 808000a0 0400080c 40019000 00009000 00c20000 00201080 600e400c 00200028 00000000 10c00000 00200000 80000180 1d400010 27800041 0c600010 00000000 40000000 00000200 08014030 00000208 00460000 40080000 000080c4 | 00010040 01005000 00100000 80010500 803814c0 00000000 0000001c 20000000 02000000 01008080 00200000 4001d000 0400801a 01800000 00001008 380b9408 10080000 80000000 11d02000 00000205 00000120 10140f00 17000080 48d8001c 10000401 00000000 008002e0 50000021 02000200 0e040001 00020000 000e0e00 |