On Target RT_HIV1 0.3668639/CHEMBL4109767
For the given ligand Velpatasvir, we have found in our database that, being scored 0.3668639, the most similar ligand is CHEMBL4109767. Check out the elaboration below.
| Velpatasvir (Given Ligand) | CHEMBL4109767 (Similar Ligand) |
|---|---|
| COC[C@H]9C[C@@H](c7ncc(c1ccc6c(c1)COc5cc4c(ccc3nc([C@@H]2CC[C@H](C)N2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]c34)cc56)[nH]7)N(C(=O)[C@H](NC(=O)OC)c8ccccc8)C9 | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(Cc2cc3cccnc3[nH]2)S(=O)(=O)c2ccc(N)cc2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0400a00a 01803809 20100d08 94010f10 001c1061 0811c01a 07480000 220a3049 00800380 004808d0 09218004 4081b800 0f808886 08712000 61020041 821e210c 00a28000 0608b022 04e02018 500a0a01 c0300008 38378e38 31802081 83d0501c 00146001 80082002 10000248 900010e8 0c034305 10e60803 e0046aa4 20006e80 | 0001001a 0080b200 03184100 15b10e01 100c00f0 0013c000 04000081 2b00700f 00c60b00 004938c0 09b12204 e000b880 8c008812 00d02021 b0262440 021e030c 18423000 0219000e 82700018 0000620d c0001900 78288eb0 23900000 cb400158 42100800 e4010406 40300800 d000206c 0c600784 2046000f e0044200 00c147e0 |