On Target PR_HIV1 0.2685185/CHEMBL450294
For the given ligand Valaciclovir, we have found in our database that, being scored 0.2685185, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Valaciclovir (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| CC(C)[C@H](N)C(=O)OCCOCn2cnc1c(=O)nc(N)[nH]c12 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 0000000a 00c01800 00080408 80010700 00080040 0000c100 0000bc04 00000840 06402100 810000f0 0c00800c 4000b010 04009000 00480000 00081080 101d900c 00220020 00008000 10400000 00201001 80080120 1c000a40 27800840 08300814 00000400 c0200002 60000200 10040060 00004208 00461000 c0200000 80000280 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |