On Target NS3_HCV1B 0.42857143/CHEMBL1170417
For the given ligand Velpatasvir, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Velpatasvir (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| COC[C@H]9C[C@@H](c7ncc(c1ccc6c(c1)COc5cc4c(ccc3nc([C@@H]2CC[C@H](C)N2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]c34)cc56)[nH]7)N(C(=O)[C@H](NC(=O)OC)c8ccccc8)C9 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0400a00a 01803809 20100d08 94010f10 001c1061 0811c01a 07480000 220a3049 00800380 004808d0 09218004 4081b800 0f808886 08712000 61020041 821e210c 00a28000 0608b022 04e02018 500a0a01 c0300008 38378e38 31802081 83d0501c 00146001 80082002 10000248 900010e8 0c034305 10e60803 e0046aa4 20006e80 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |