On Target NS3_HCV1B 0.15946844/CHEMBL3125634
For the given ligand Cidofovir, we have found in our database that, being scored 0.15946844, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Cidofovir (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 00000002 00100800 80000000 48080600 00080061 00004100 00009002 00000800 0400010a 808000a0 0400080c 40019000 00009000 00c20000 00201080 600e400c 00200028 00000000 10c00000 00200000 80000180 1d400010 27800041 0c600010 00000000 40000000 00000200 08014030 00000208 00460000 40080000 000080c4 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |