On Target NS3_HCV1A 0.34862384/CHEMBL3696815
For the given ligand Cidofovir, we have found in our database that, being scored 0.34862384, the most similar ligand is CHEMBL3696815. Check out the elaboration below.
| Cidofovir (Given Ligand) | CHEMBL3696815 (Similar Ligand) |
|---|---|
| Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(N)C1O)Oc1ccccc1 |
|
|
|
|
|
|
| 00000002 00100800 80000000 48080600 00080061 00004100 00009002 00000800 0400010a 808000a0 0400080c 40019000 00009000 00c20000 00201080 600e400c 00200028 00000000 10c00000 00200000 80000180 1d400010 27800041 0c600010 00000000 40000000 00000200 08014030 00000208 00460000 40080000 000080c4 | 00200002 01540108 30000310 c9090f40 40180074 00084140 0202d401 80000820 0d004101 818008f4 0400100c 4845b16c 00009002 03ca0130 00289880 009d8a8c 002a0030 00000001 29c60000 00225043 a0080020 3e000a10 27800041 08600810 18000400 40002002 0f001200 10038060 02001289 01460034 55680000 201390c4 |