On Target RT_HIV1 0.407767/CHEMBL3683708
For the given ligand Indinavir, we have found in our database that, being scored 0.407767, the most similar ligand is CHEMBL3683708. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL3683708 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | COC(=O)N[C@H](C(=O)NCCC(F)(F)C[C@@H](CO)N(C(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 00000012 01803200 01100100 05b10600 00080090 00818000 00000000 2100000c 00c40a00 004808c0 08302004 6001b000 0c008002 00802001 80600040 001e0408 100a2000 02080000 00402018 00006609 c0000100 38240e30 23100001 db500058 02000800 a0000006 00000060 d000006c 0c000680 2806000b a0004000 00012670 |