On Target PR_HIV1 0.23144105/CHEMBL449291
For the given ligand Lamivudine, we have found in our database that, being scored 0.23144105, the most similar ligand is CHEMBL449291. Check out the elaboration below.
| Lamivudine (Given Ligand) | CHEMBL449291 (Similar Ligand) |
|---|---|
| Nc2ccn([C@@H]1CS[C@H](CO)O1)c(=O)n2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCS(=O)(=O)CCOC2)cc1 |
|
|
|
|
|
|
| 00000002 40400000 20000001 88180640 04080040 00006000 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc0010 05a05080 001c100c 04240006 00200000 00402000 00201000 80080000 18000000 25800241 08600800 00030400 40000012 00000200 90003060 00000209 01460000 c0280000 060100c0 | 00000010 05c05409 2110050b 01b10600 000810c0 00028020 02000000 20000044 00542a00 014849e0 0830b000 60018010 00008002 80240001 81e80011 001a0008 14022000 02080000 01400800 01027603 80000120 18280c90 07100240 d9500058 02020400 8000001e 00800020 102020ec 04000600 22060013 80000000 04012670 |