On Target PA_INFA 0.28125/CHEMBL2040578
For the given ligand Delavirdine, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL2040578. Check out the elaboration below.
| Delavirdine (Given Ligand) | CHEMBL2040578 (Similar Ligand) |
|---|---|
| CC(C)Nc1cccnc1N4CCN(C(=O)c3cc2cc(NS(C)(=O)=O)ccc2[nH]3)CC4 | CC(NC(=O)c1nc(-c2cnccn2)[nH]c(=O)c1O)c1ccccc1 |
|
|
|
|
|
|
| 00004002 0080a800 00004123 14310e20 00040020 08100000 00000000 02203009 00000000 20010ac0 00292004 40008000 00008c02 00502001 800e0441 02160104 00040000 0200400e 08200000 00a04004 40100000 2e068e08 20802820 8260001e 00100082 c0100000 00000480 8000008c 0840811c 00460801 80041200 000142e0 | 00000202 00811808 40000100 10050e10 00000068 00124006 00c09800 0a003405 16000100 40180860 08290004 40048810 00008802 00708003 00820400 000c200c 08002068 1200b022 80c00000 10400000 80000000 48008600 21800040 4050011c 00044806 c0000680 28000030 80041004 0000410c 07660c03 c4048000 500006a0 |