On Target NSP15_SARS 0.33333334/CHEMBL2441745
For the given ligand Nelfinavir, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |