On Target PR_SARS 0.1521739/CHEMBL2441741
For the given ligand Rilpivirine, we have found in our database that, being scored 0.1521739, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Rilpivirine (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Cc1cc(/C=C/C#N)cc(C)c1Nc3ccnc(Nc2ccc(C#N)cc2)n3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000202 00000800 00000100 08090620 02000029 00004000 8000a090 00000cc0 00002100 00800840 00300004 41029000 04000000 00008000 00020042 000c000c 00440400 12004000 08c0000a 10a00000 40080000 0c040000 21804c40 00400000 00000000 80000000 02402100 400110c0 0048c008 00660c00 44000000 000020c0 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |