On Target NS5B_HCV1A 0.046511628/CHEMBL3644878
For the given ligand Foscarnet, we have found in our database that, being scored 0.046511628, the most similar ligand is CHEMBL3644878. Check out the elaboration below.
| Foscarnet (Given Ligand) | CHEMBL3644878 (Similar Ligand) |
|---|---|
| O=C(O)P(=O)(O)O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(CC(=O)c2ccccc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00000000 00000800 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00008000 00020000 00000000 00000008 00000028 00080004 00000000 00000000 00000000 05400800 00000000 00000000 00000000 00000000 00000000 00014000 00000000 00000000 04000000 00008004 | 00010080 0d403c00 00100100 05310f00 00080000 00018000 000a0004 a0003408 10800280 005a89e8 08202400 4001b000 0e00f002 01042101 80400400 001a8008 02824018 02082000 40610850 00004201 00000100 bc270e10 01000003 b344003c 02013000 80001002 00000000 9020002c 0c000200 81060093 a4184000 01012670 |