On Target PR_HIV1 0.029411765/CHEMBL517126
For the given ligand Foscarnet, we have found in our database that, being scored 0.029411765, the most similar ligand is CHEMBL517126. Check out the elaboration below.
| Foscarnet (Given Ligand) | CHEMBL517126 (Similar Ligand) |
|---|---|
| O=C(O)P(=O)(O)O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOCOC2)cc1 |
|
|
|
|
|
|
| 00000000 00000800 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00008000 00020000 00000000 00000008 00000028 00080004 00000000 00000000 00000000 05400800 00000000 00000000 00000000 00000000 00000000 00014000 00000000 00000000 04000000 00008004 | 00000010 01c05409 2110050a 01b10700 00281080 00028000 02002800 28000004 00742a00 014809e0 08302000 60018010 00008002 00200101 81e80001 003a0008 10022000 02080000 11408800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000100e 00800000 342100cc 04000600 2006001b 80a00000 00012670 |