On Target PR_HIV1 0.23041475/CHEMBL450294
For the given ligand Edoxudine, we have found in our database that, being scored 0.23041475, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Edoxudine (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| CCc2cn([C@H]1C[C@H](O)[C@@H](CO)O1)c(=O)[nH]c2=O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 08000002 01402000 00001000 82010618 00180062 00004140 00002400 00000000 06400100 818800b0 2c00000c 40018000 00009000 03c80110 00a81080 001c800c 00200000 82008000 09c01000 40001001 84080020 10000010 25800041 08300414 10040400 c0000002 20000200 10040060 00004200 01460000 40280004 00000080 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |