On Target PLP_SARS 0.17721519/CHEMBL213054
For the given ligand Tenofovir alafenamide, we have found in our database that, being scored 0.17721519, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Tenofovir alafenamide (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)Oc3ccccc3 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0020000b 00941808 b0080400 c8090660 40080051 0000c100 8200c002 00000920 09600108 000088c4 0000800c 4841b048 00009002 00820000 00089080 308ec00d 02220038 00000001 50460200 80220000 a00000a0 1b400a52 23800040 24000214 40020500 00002000 03001200 0843c030 42001209 20460020 c0080000 200090d4 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |