On Target NS5B_HCV1A 0.20872274/CHEMBL3644940
For the given ligand Tenofovir alafenamide, we have found in our database that, being scored 0.20872274, the most similar ligand is CHEMBL3644940. Check out the elaboration below.
| Tenofovir alafenamide (Given Ligand) | CHEMBL3644940 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)Oc3ccccc3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2cc(Nc3ccccc3)nc(OC)n2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0020000b 00941808 b0080400 c8090660 40080051 0000c100 8200c002 00000920 09600108 000088c4 0000800c 4841b048 00009002 00820000 00089080 308ec00d 02220038 00000001 50460200 80220000 a00000a0 1b400a52 23800040 24000214 40020500 00002000 03001200 0843c030 42001209 20460020 c0080000 200090d4 | 00030486 0d403410 00100120 0d390f00 a0080000 0001c100 000a8814 a0103c09 10802300 00528be8 00302424 7001b050 0e00f102 01042101 a0c20640 001e800c 12865010 10486000 4861085a 10205a01 60120300 be050e10 21824043 3204003a 02192000 00f01102 02000400 902000ac 0a008218 81460093 e4185000 050122f0 |