On Target NS3_HCV1B 0.31578946/CHEMBL1170410
For the given ligand Elvitegravir, we have found in our database that, being scored 0.31578946, the most similar ligand is CHEMBL1170410. Check out the elaboration below.
| Elvitegravir (Given Ligand) | CHEMBL1170410 (Similar Ligand) |
|---|---|
| COc1cc3c(cc1Cc2cccc(Cl)c2F)c(=O)c(C(=O)O)cn3[C@H](CO)C(C)C | C=CCCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 00008042 0480d808 20104108 02010610 00041003 0000c070 06000000 01000208 02000100 c00808c4 08000004 40018800 02008806 00601000 81000041 000c600c 01000200 82004004 00600000 00860001 c0000000 18068b78 23804000 9650001c 00042040 e0001001 08000000 50040011 00400380 40068042 c2040000 00220600 | 08012082 65c03008 20104108 15310600 00241023 00018080 96060080 22081408 00800284 105988c0 08202404 4003b000 0f00c802 00442001 c1420541 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |