On Target PLP_SARS 0.13709678/CHEMBL222735
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.13709678, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |