On Target NP_HCoV-OC43 0.10377359/CHEMBL3233481
For the given ligand asiprin, we have found in our database that, being scored 0.10377359, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| asiprin (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |