On Target NP_HCoV-OC43 0.11111111/CHEMBL3233481
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.11111111, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |