On Target NA_INFB 0.14634146/CHEMBL195288
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.14634146, the most similar ligand is CHEMBL195288. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL195288 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ncc[nH]1 |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 0401000a 01003000 00100420 14000400 000800c0 00000010 01000020 20000008 00000100 00000280 00208000 40013000 0600801a 01802001 811a0000 000c000c 10000000 0c000000 00402008 00000201 20100000 30040e30 23000001 02100018 00001000 00000000 00000000 10000180 08000004 00c60801 40024000 20802a00 |