On Target NS5B_HCV1A 0.145/CHEMBL353549
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.145, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |