On Target RT_HIV1 0.18181819/CHEMBL4288759
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL4288759. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL4288759 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | O=c1nc(Nc2ccc(-c3cnc4ccccc4c3)cc2)c2cccnc2n1O |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 01002002 00c00800 00084100 48090610 00041000 04004108 00009010 40000800 04002100 00000860 04300004 40049000 04008800 00c080c0 003000c0 900c0014 00060040 12014004 0c60000a 10200002 40802000 08078068 30804040 80c00004 00040001 c0080000 2a008280 000000e0 0040c008 00460000 c0040000 800000c0 |