On Target PA_INFA 0.15204678/CHEMBL2040578
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.15204678, the most similar ligand is CHEMBL2040578. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL2040578 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | CC(NC(=O)c1nc(-c2cnccn2)[nH]c(=O)c1O)c1ccccc1 |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 00000202 00811808 40000100 10050e10 00000068 00124006 00c09800 0a003405 16000100 40180860 08290004 40048810 00008802 00708003 00820400 000c200c 08002068 1200b022 80c00000 10400000 80000000 48008600 21800040 4050011c 00044806 c0000680 28000030 80041004 0000410c 07660c03 c4048000 500006a0 |