On Target NP_HCoV-OC43 0.12033195/CHEMBL3233481
For the given ligand Sofosbuvir, we have found in our database that, being scored 0.12033195, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Sofosbuvir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]2O[C@@H](n1ccc(=O)[nH]c1=O)[C@](C)(F)[C@@H]2O)Oc3ccccc3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00200002 01540108 38100910 83010f40 40180074 00084140 02024413 80000020 0f004100 818008f4 0c00100c 4845b168 00009002 03ca0130 00a89080 009c8a8c 002a0030 00008001 29c60000 00025043 a00801a0 1e000a10 27800041 08700010 10040400 c0202002 2f0012a0 10078060 22005281 09460034 55680020 20139684 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |