On Target NP_HCoV-OC43 0.21804512/CHEMBL3233481
For the given ligand Brequinar, we have found in our database that, being scored 0.21804512, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |