On Target RT_HIV1 0.3233533/CHEMBL4288759
For the given ligand Brequinar, we have found in our database that, being scored 0.3233533, the most similar ligand is CHEMBL4288759. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL4288759 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | O=c1nc(Nc2ccc(-c3cnc4ccccc4c3)cc2)c2cccnc2n1O |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 01002002 00c00800 00084100 48090610 00041000 04004108 00009010 40000800 04002100 00000860 04300004 40049000 04008800 00c080c0 003000c0 900c0014 00060040 12014004 0c60000a 10200002 40802000 08078068 30804040 80c00004 00040001 c0080000 2a008280 000000e0 0040c008 00460000 c0040000 800000c0 |