On Target DPM_HHV1K 0.1981982/CHEMBL481172
For the given ligand Sofosbuvir, we have found in our database that, being scored 0.1981982, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| Sofosbuvir (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]2O[C@@H](n1ccc(=O)[nH]c1=O)[C@](C)(F)[C@@H]2O)Oc3ccccc3 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 00200002 01540108 38100910 83010f40 40180074 00084140 02024413 80000020 0f004100 818008f4 0c00100c 4845b168 00009002 03ca0130 00a89080 009c8a8c 002a0030 00008001 29c60000 00025043 a00801a0 1e000a10 27800041 08700010 10040400 c0202002 2f0012a0 10078060 22005281 09460034 55680020 20139684 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |